C18H34O3Si — CID 101063399
2-[(4R,5S)-5-[(1E)-buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 101063399) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is 2-[(4R,5S)-5-[(1E)-buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(4R,5S)-5-[(1E)-buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101063399 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[(4R,5S)-5-[(1E)-buta-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | C=C/C=C/[C@H]1COC(C)(C)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-9-10-11-15-14-19-18(5,6)21-16(15)12-13-20-22(7,8)17(2,3)4/h9-11,15-16H,1,12-14H2,2-8H3/b11-10+/t15-,16+/m0/s1 |
| InChIKey | CKVHWSJNFTVOIW-ZBYDSPNZSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|