C33H44OSi2 — CID 101063552
2,4-dibutyl-3,5-bis(methyl-phenyl-prop-2-enylsilyl)cyclopenta-2,4-dien-1-one (PubChem CID 101063552) has the molecular formula C33H44OSi2 and a molecular weight of 512.89 g/mol. Its IUPAC name is 2,4-dibutyl-3,5-bis(methyl-phenyl-prop-2-enylsilyl)cyclopenta-2,4-dien-1-one.
| Compound Name | 2,4-dibutyl-3,5-bis(methyl-phenyl-prop-2-enylsilyl)cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 101063552 |
| Molecular Formula | C33H44OSi2 |
| Molecular Weight | 512.89 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 2,4-dibutyl-3,5-bis(methyl-phenyl-prop-2-enylsilyl)cyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C)(C1=C(CCCC)C([Si](C)(CC=C)c2ccccc2)=C(CCCC)C1=O)c1ccccc1 |
| InChI | InChI=1S/C33H44OSi2/c1-7-11-23-29-31(34)33(36(6,26-10-4)28-21-17-14-18-22-28)30(24-12-8-2)32(29)35(5,25-9-3)27-19-15-13-16-20-27/h9-10,13-22H,3-4,7-8,11-12,23-26H2,1-2,5-6H3 |
| InChIKey | ZIBLEXOVRRHUFV-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.89 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|