C38H36OSi2 — CID 101063556
1,3-bis[diphenyl(prop-2-enyl)silyl]-5,6-dihydro-4H-pentalen-2-one (PubChem CID 101063556) has the molecular formula C38H36OSi2 and a molecular weight of 564.88 g/mol. Its IUPAC name is 1,3-bis[diphenyl(prop-2-enyl)silyl]-5,6-dihydro-4H-pentalen-2-one.
| Compound Name | 1,3-bis[diphenyl(prop-2-enyl)silyl]-5,6-dihydro-4H-pentalen-2-one |
|---|---|
| PubChem CID | 101063556 |
| Molecular Formula | C38H36OSi2 |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 1,3-bis[diphenyl(prop-2-enyl)silyl]-5,6-dihydro-4H-pentalen-2-one |
| SMILES | C=CC[Si](C1=C2CCCC2=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H36OSi2/c1-3-28-40(30-18-9-5-10-19-30,31-20-11-6-12-21-31)37-34-26-17-27-35(34)38(36(37)39)41(29-4-2,32-22-13-7-14-23-32)33-24-15-8-16-25-33/h3-16,18-25H,1-2,17,26-29H2 |
| InChIKey | PYMWDKKQLJBHFJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|