C37H36OSi2 — CID 15400139
2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-dimethylcyclopenta-2,4-dien-1-one (PubChem CID 15400139) has the molecular formula C37H36OSi2 and a molecular weight of 552.87 g/mol. Its IUPAC name is 2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-dimethylcyclopenta-2,4-dien-1-one.
| Compound Name | 2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-dimethylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 15400139 |
| Molecular Formula | C37H36OSi2 |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-dimethylcyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C1=C(C)C(C)=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H36OSi2/c1-5-27-39(31-19-11-7-12-20-31,32-21-13-8-14-22-32)36-29(3)30(4)37(35(36)38)40(28-6-2,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h5-26H,1-2,27-28H2,3-4H3 |
| InChIKey | JYMPWCMKWSNTOI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|