C36H48OSiSn — CID 15681860
(E,2E)-2-(tributylstannylmethylidene)-1-triphenylsilylpent-3-en-1-one (PubChem CID 15681860) has the molecular formula C36H48OSiSn and a molecular weight of 643.58 g/mol. Its IUPAC name is (E,2E)-2-(tributylstannylmethylidene)-1-triphenylsilylpent-3-en-1-one.
| Compound Name | (E,2E)-2-(tributylstannylmethylidene)-1-triphenylsilylpent-3-en-1-one |
|---|---|
| PubChem CID | 15681860 |
| Molecular Formula | C36H48OSiSn |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | (E,2E)-2-(tributylstannylmethylidene)-1-triphenylsilylpent-3-en-1-one |
| SMILES | C/C=C/C(=C\[Sn](CCCC)(CCCC)CCCC)C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21OSi.3C4H9.Sn/c1-3-13-20(2)24(25)26(21-14-7-4-8-15-21,22-16-9-5-10-17-22)23-18-11-6-12-19-23;3*1-3-4-2;/h2-19H,1H3;3*1,3-4H2,2H3;/b13-3+,20-2?;;;; |
| InChIKey | ADIPLMYUHIIHHW-TYWBRIMSSA-N |
| XLogP | 8.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|