C35H46O2SiSn — CID 15681859
(2E)-2-(tributylstannylmethylidene)-1-triphenylsilylbutane-1,3-dione (PubChem CID 15681859) has the molecular formula C35H46O2SiSn and a molecular weight of 645.55 g/mol. Its IUPAC name is (2E)-2-(tributylstannylmethylidene)-1-triphenylsilylbutane-1,3-dione.
| Compound Name | (2E)-2-(tributylstannylmethylidene)-1-triphenylsilylbutane-1,3-dione |
|---|---|
| PubChem CID | 15681859 |
| Molecular Formula | C35H46O2SiSn |
| Molecular Weight | 645.55 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | (2E)-2-(tributylstannylmethylidene)-1-triphenylsilylbutane-1,3-dione |
| SMILES | CCCC[Sn](/C=C(\C(C)=O)C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(CCCC)CCCC |
| InChI | InChI=1S/C23H19O2Si.3C4H9.Sn/c1-18(19(2)24)23(25)26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22;3*1-3-4-2;/h1,3-17H,2H3;3*1,3-4H2,2H3; |
| InChIKey | HFHUIHKKKAIIHQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|