C23H20O2Si — CID 101115094
(E)-1-triphenylsilylpent-2-ene-1,4-dione (PubChem CID 101115094) has the molecular formula C23H20O2Si and a molecular weight of 356.50 g/mol. Its IUPAC name is (E)-1-triphenylsilylpent-2-ene-1,4-dione.
| Compound Name | (E)-1-triphenylsilylpent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 101115094 |
| Molecular Formula | C23H20O2Si |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (E)-1-triphenylsilylpent-2-ene-1,4-dione |
| SMILES | CC(=O)/C=C/C(=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O2Si/c1-19(24)17-18-23(25)26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18H,1H3/b18-17+ |
| InChIKey | OJFAIPLZQMAOIF-ISLYRVAYSA-N |
| XLogP | 2.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|