C23H29FO2Si — CID 11531103
(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-5-methylhex-3-en-2-one (PubChem CID 11531103) has the molecular formula C23H29FO2Si and a molecular weight of 384.57 g/mol. Its IUPAC name is (E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-5-methylhex-3-en-2-one.
| Compound Name | (E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-5-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 11531103 |
| Molecular Formula | C23H29FO2Si |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-3-fluoro-5-methylhex-3-en-2-one |
| SMILES | CC(=O)/C(F)=C\[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29FO2Si/c1-18(16-22(24)19(2)25)17-26-27(23(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,18H,17H2,1-5H3/b22-16+/t18-/m1/s1 |
| InChIKey | QXHXLCXYSNXQPB-IPEVAPCJSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|