C35H32OSi2 — CID 11005892
2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one (PubChem CID 11005892) has the molecular formula C35H32OSi2 and a molecular weight of 524.81 g/mol. Its IUPAC name is 2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 11005892 |
| Molecular Formula | C35H32OSi2 |
| Molecular Weight | 524.81 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C1=CC=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H32OSi2/c1-3-27-37(29-17-9-5-10-18-29,30-19-11-6-12-20-30)33-25-26-34(35(33)36)38(28-4-2,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h3-26H,1-2,27-28H2 |
| InChIKey | RWMVLIKTHLZUCT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.81 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|