C22H24O2Si2 — CID 4867671
2,5-bis[dimethyl(phenyl)silyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 4867671) has the molecular formula C22H24O2Si2 and a molecular weight of 376.60 g/mol. Its IUPAC name is 2,5-bis[dimethyl(phenyl)silyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[dimethyl(phenyl)silyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 4867671 |
| Molecular Formula | C22H24O2Si2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2,5-bis[dimethyl(phenyl)silyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | C[Si](C)(C1=CC(=O)C([Si](C)(C)c2ccccc2)=CC1=O)c1ccccc1 |
| InChI | InChI=1S/C22H24O2Si2/c1-25(2,17-11-7-5-8-12-17)21-15-20(24)22(16-19(21)23)26(3,4)18-13-9-6-10-14-18/h5-16H,1-4H3 |
| InChIKey | MIKRPTLUYBHXSR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|