C43H48OSi2 — CID 15400127
3,4-dibutyl-2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one (PubChem CID 15400127) has the molecular formula C43H48OSi2 and a molecular weight of 637.03 g/mol. Its IUPAC name is 3,4-dibutyl-2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 3,4-dibutyl-2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 15400127 |
| Molecular Formula | C43H48OSi2 |
| Molecular Weight | 637.03 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 3,4-dibutyl-2,5-bis[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C1=C(CCCC)C(CCCC)=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H48OSi2/c1-5-9-31-39-40(32-10-6-2)43(46(34-8-4,37-27-19-13-20-28-37)38-29-21-14-22-30-38)41(44)42(39)45(33-7-3,35-23-15-11-16-24-35)36-25-17-12-18-26-36/h7-8,11-30H,3-6,9-10,31-34H2,1-2H3 |
| InChIKey | UUHFQRBBDJLGTL-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.03 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|