C41H32OSi2 — CID 102500774
2,5-bis(triphenylsilyl)cyclopenta-2,4-dien-1-one (PubChem CID 102500774) has the molecular formula C41H32OSi2 and a molecular weight of 596.88 g/mol. Its IUPAC name is 2,5-bis(triphenylsilyl)cyclopenta-2,4-dien-1-one.
| Compound Name | 2,5-bis(triphenylsilyl)cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 102500774 |
| Molecular Formula | C41H32OSi2 |
| Molecular Weight | 596.88 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 2,5-bis(triphenylsilyl)cyclopenta-2,4-dien-1-one |
| SMILES | O=C1C([Si](c2ccccc2)(c2ccccc2)c2ccccc2)=CC=C1[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H32OSi2/c42-41-39(43(33-19-7-1-8-20-33,34-21-9-2-10-22-34)35-23-11-3-12-24-35)31-32-40(41)44(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-32H |
| InChIKey | GXAFBPUXCXYYRG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|