C47H40OSi2 — CID 10897710
2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 10897710) has the molecular formula C47H40OSi2 and a molecular weight of 677.01 g/mol. Its IUPAC name is 2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-diphenylcyclopenta-2,4-dien-1-one.
| Compound Name | 2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-diphenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 10897710 |
| Molecular Formula | C47H40OSi2 |
| Molecular Weight | 677.01 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 2,5-bis[diphenyl(prop-2-enyl)silyl]-3,4-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C1=C(c2ccccc2)C(c2ccccc2)=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H40OSi2/c1-3-35-49(39-27-15-7-16-28-39,40-29-17-8-18-30-40)46-43(37-23-11-5-12-24-37)44(38-25-13-6-14-26-38)47(45(46)48)50(36-4-2,41-31-19-9-20-32-41)42-33-21-10-22-34-42/h3-34H,1-2,35-36H2 |
| InChIKey | ODRCBDMWMWQMBY-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.01 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|