C50H46OSi3 — CID 134977397
2,3,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one (PubChem CID 134977397) has the molecular formula C50H46OSi3 and a molecular weight of 747.17 g/mol. Its IUPAC name is 2,3,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 2,3,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 134977397 |
| Molecular Formula | C50H46OSi3 |
| Molecular Weight | 747.17 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | 2,3,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C1=CC([Si](CC=C)(c2ccccc2)c2ccccc2)=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H46OSi3/c1-4-37-52(41-25-13-7-14-26-41,42-27-15-8-16-28-42)47-40-48(53(38-5-2,43-29-17-9-18-30-43)44-31-19-10-20-32-44)50(49(47)51)54(39-6-3,45-33-21-11-22-34-45)46-35-23-12-24-36-46/h4-36,40H,1-3,37-39H2 |
| InChIKey | VSRIAKGCQBUSLD-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.17 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|