C54H54OSi3 — CID 134977398
3-butyl-2,4,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one (PubChem CID 134977398) has the molecular formula C54H54OSi3 and a molecular weight of 803.28 g/mol. Its IUPAC name is 3-butyl-2,4,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 3-butyl-2,4,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 134977398 |
| Molecular Formula | C54H54OSi3 |
| Molecular Weight | 803.28 g/mol |
| Exact Mass | 802.35 |
| IUPAC Name | 3-butyl-2,4,5-tris[diphenyl(prop-2-enyl)silyl]cyclopenta-2,4-dien-1-one |
| SMILES | C=CC[Si](C1=C(CCCC)C([Si](CC=C)(c2ccccc2)c2ccccc2)=C([Si](CC=C)(c2ccccc2)c2ccccc2)C1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H54OSi3/c1-5-9-40-50-52(56(41-6-2,44-28-16-10-17-29-44)45-30-18-11-19-31-45)51(55)54(58(43-8-4,48-36-24-14-25-37-48)49-38-26-15-27-39-49)53(50)57(42-7-3,46-32-20-12-21-33-46)47-34-22-13-23-35-47/h6-8,10-39H,2-5,9,40-43H2,1H3 |
| InChIKey | GVFXNKODIUDTOY-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.28 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|