C35H40OSi2 — CID 138979741
(E,7S)-5,7-bis[dimethyl(phenyl)silyl]-1,7-diphenylhept-5-en-3-one (PubChem CID 138979741) has the molecular formula C35H40OSi2 and a molecular weight of 532.88 g/mol. Its IUPAC name is (E,7S)-5,7-bis[dimethyl(phenyl)silyl]-1,7-diphenylhept-5-en-3-one.
| Compound Name | (E,7S)-5,7-bis[dimethyl(phenyl)silyl]-1,7-diphenylhept-5-en-3-one |
|---|---|
| PubChem CID | 138979741 |
| Molecular Formula | C35H40OSi2 |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (E,7S)-5,7-bis[dimethyl(phenyl)silyl]-1,7-diphenylhept-5-en-3-one |
| SMILES | C[Si](C)(/C(=C/[C@@H](c1ccccc1)[Si](C)(C)c1ccccc1)CC(=O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H40OSi2/c1-37(2,32-21-13-7-14-22-32)34(27-31(36)26-25-29-17-9-5-10-18-29)28-35(30-19-11-6-12-20-30)38(3,4)33-23-15-8-16-24-33/h5-24,28,35H,25-27H2,1-4H3/b34-28+/t35-/m0/s1 |
| InChIKey | ONACSIUMRWMOMV-JABWTZMZSA-N |
| XLogP | 7.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|