C39H44OSi2 — CID 15400117
3,4-dibutyl-2,5-bis[methyl(diphenyl)silyl]cyclopenta-2,4-dien-1-one (PubChem CID 15400117) has the molecular formula C39H44OSi2 and a molecular weight of 584.95 g/mol. Its IUPAC name is 3,4-dibutyl-2,5-bis[methyl(diphenyl)silyl]cyclopenta-2,4-dien-1-one.
| Compound Name | 3,4-dibutyl-2,5-bis[methyl(diphenyl)silyl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 15400117 |
| Molecular Formula | C39H44OSi2 |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 3,4-dibutyl-2,5-bis[methyl(diphenyl)silyl]cyclopenta-2,4-dien-1-one |
| SMILES | CCCCC1=C([Si](C)(c2ccccc2)c2ccccc2)C(=O)C([Si](C)(c2ccccc2)c2ccccc2)=C1CCCC |
| InChI | InChI=1S/C39H44OSi2/c1-5-7-29-35-36(30-8-6-2)39(42(4,33-25-17-11-18-26-33)34-27-19-12-20-28-34)37(40)38(35)41(3,31-21-13-9-14-22-31)32-23-15-10-16-24-32/h9-28H,5-8,29-30H2,1-4H3 |
| InChIKey | FJDNVLYXSUVNOZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|