C16H23IO2 — CID 101063738
(2S,3R)-3-iodo-2-[(1S)-1-(2-methylcyclohexen-1-yl)but-3-ynoxy]oxane (PubChem CID 101063738) has the molecular formula C16H23IO2 and a molecular weight of 374.26 g/mol. Its IUPAC name is (2S,3R)-3-iodo-2-[(1S)-1-(2-methylcyclohexen-1-yl)but-3-ynoxy]oxane.
| Compound Name | (2S,3R)-3-iodo-2-[(1S)-1-(2-methylcyclohexen-1-yl)but-3-ynoxy]oxane |
|---|---|
| PubChem CID | 101063738 |
| Molecular Formula | C16H23IO2 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (2S,3R)-3-iodo-2-[(1S)-1-(2-methylcyclohexen-1-yl)but-3-ynoxy]oxane |
| SMILES | C#CC[C@H](O[C@@H]1OCCC[C@H]1I)C1=C(C)CCCC1 |
| InChI | InChI=1S/C16H23IO2/c1-3-7-15(13-9-5-4-8-12(13)2)19-16-14(17)10-6-11-18-16/h1,14-16H,4-11H2,2H3/t14-,15+,16+/m1/s1 |
| InChIKey | QIHOQNACRQXMJM-PMPSAXMXSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|