C18H27IO2 — CID 101063741
(2S,3R)-3-iodo-2-[(1R)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-ynoxy]oxane (PubChem CID 101063741) has the molecular formula C18H27IO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is (2S,3R)-3-iodo-2-[(1R)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-ynoxy]oxane.
| Compound Name | (2S,3R)-3-iodo-2-[(1R)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-ynoxy]oxane |
|---|---|
| PubChem CID | 101063741 |
| Molecular Formula | C18H27IO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (2S,3R)-3-iodo-2-[(1R)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-ynoxy]oxane |
| SMILES | C#CC[C@@H](O[C@@H]1OCCC[C@H]1I)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H27IO2/c1-5-8-15(21-17-14(19)10-7-12-20-17)16-13(2)9-6-11-18(16,3)4/h1,14-15,17H,6-12H2,2-4H3/t14-,15-,17+/m1/s1 |
| InChIKey | GUDBMHLKZWKFSL-INMHGKMJSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|