C23H31IO3 — CID 10696151
2-[(5R)-5-[(Z,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]-5,5-dimethyl-1,3-dioxane (PubChem CID 10696151) has the molecular formula C23H31IO3 and a molecular weight of 482.40 g/mol. Its IUPAC name is 2-[(5R)-5-[(Z,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-[(5R)-5-[(Z,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 10696151 |
| Molecular Formula | C23H31IO3 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-[(5R)-5-[(Z,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]-5,5-dimethyl-1,3-dioxane |
| SMILES | CO[C@H](C#C/C=C\C#CI)[C@@H]1CCC(C)=C(C2OCC(C)(C)CO2)C1(C)C |
| InChI | InChI=1S/C23H31IO3/c1-17-12-13-18(19(25-6)11-9-7-8-10-14-24)23(4,5)20(17)21-26-15-22(2,3)16-27-21/h7-8,18-19,21H,12-13,15-16H2,1-6H3/b8-7-/t18-,19+/m0/s1 |
| InChIKey | FJRQEDMRYWWWPL-AWTIPJNISA-N |
| XLogP | 5.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|