C18H25IO2 — CID 101063745
(2S,3R)-2-[(1S)-1-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]but-3-ynoxy]-3-iodooxane (PubChem CID 101063745) has the molecular formula C18H25IO2 and a molecular weight of 400.30 g/mol. Its IUPAC name is (2S,3R)-2-[(1S)-1-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]but-3-ynoxy]-3-iodooxane.
| Compound Name | (2S,3R)-2-[(1S)-1-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]but-3-ynoxy]-3-iodooxane |
|---|---|
| PubChem CID | 101063745 |
| Molecular Formula | C18H25IO2 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (2S,3R)-2-[(1S)-1-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]but-3-ynoxy]-3-iodooxane |
| SMILES | C#CC[C@H](O[C@@H]1OCCC[C@H]1I)C1=CC[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C18H25IO2/c1-4-6-16(21-17-15(19)7-5-10-20-17)13-9-8-12-11-14(13)18(12,2)3/h1,9,12,14-17H,5-8,10-11H2,2-3H3/t12-,14+,15+,16-,17-/m0/s1 |
| InChIKey | MBBXFOWGUPHLSR-WFKFIOEPSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|