C13H21B — CID 101066149
1,2,3,4,5,6,7-heptamethylborepine (PubChem CID 101066149) has the molecular formula C13H21B and a molecular weight of 188.12 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptamethylborepine.
| Compound Name | 1,2,3,4,5,6,7-heptamethylborepine |
|---|---|
| PubChem CID | 101066149 |
| Molecular Formula | C13H21B |
| Molecular Weight | 188.12 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | 1,2,3,4,5,6,7-heptamethylborepine |
| SMILES | CB1C(C)=C(C)C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C13H21B/c1-8-9(2)11(4)13(6)14(7)12(5)10(8)3/h1-7H3 |
| InChIKey | QYZUEEYPSDPODS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.12 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|