C9H15B — CID 134862348
1,2,3,4,5-pentamethylborole (PubChem CID 134862348) has the molecular formula C9H15B and a molecular weight of 134.03 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylborole.
| Compound Name | 1,2,3,4,5-pentamethylborole |
|---|---|
| PubChem CID | 134862348 |
| Molecular Formula | C9H15B |
| Molecular Weight | 134.03 g/mol |
| Exact Mass | 134.13 |
| IUPAC Name | 1,2,3,4,5-pentamethylborole |
| SMILES | CB1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C9H15B/c1-6-7(2)9(4)10(5)8(6)3/h1-5H3 |
| InChIKey | WSIONUGLPCESOQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.03 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|