C8H12Zr — CID 135043844
3,4-dimethylhexa-2,4-diene;zirconium(2+) (PubChem CID 135043844) has the molecular formula C8H12Zr and a molecular weight of 199.41 g/mol. Its IUPAC name is 3,4-dimethylhexa-2,4-diene;zirconium(2+).
| Compound Name | 3,4-dimethylhexa-2,4-diene;zirconium(2+) |
|---|---|
| PubChem CID | 135043844 |
| Molecular Formula | C8H12Zr |
| Molecular Weight | 199.41 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 3,4-dimethylhexa-2,4-diene;zirconium(2+) |
| SMILES | C/[C-]=C(C)/C(C)=[C-]/C.[Zr+2] |
| InChI | InChI=1S/C8H12.Zr/c1-5-7(3)8(4)6-2;/h1-4H3;/q-2;+2 |
| InChIKey | ZHBHEZCSLJVRKD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|