C10H18Sn — CID 135048636
1,1,2,3,4,5-hexamethylstannole (PubChem CID 135048636) has the molecular formula C10H18Sn and a molecular weight of 256.96 g/mol. Its IUPAC name is 1,1,2,3,4,5-hexamethylstannole.
| Compound Name | 1,1,2,3,4,5-hexamethylstannole |
|---|---|
| PubChem CID | 135048636 |
| Molecular Formula | C10H18Sn |
| Molecular Weight | 256.96 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1,1,2,3,4,5-hexamethylstannole |
| SMILES | CC1=C(C)[Sn](C)(C)C(C)=C1C |
| InChI | InChI=1S/C8H12.2CH3.Sn/c1-5-7(3)8(4)6-2;;;/h1-4H3;2*1H3; |
| InChIKey | QTXWQEGJXJRZPF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |