C13H28Sn2 — CID 15798780
(3,4-diethyl-1,1-dimethyl-2,5-dihydrostannol-2-yl)-trimethylstannane (PubChem CID 15798780) has the molecular formula C13H28Sn2 and a molecular weight of 421.79 g/mol. Its IUPAC name is (3,4-diethyl-1,1-dimethyl-2,5-dihydrostannol-2-yl)-trimethylstannane.
| Compound Name | (3,4-diethyl-1,1-dimethyl-2,5-dihydrostannol-2-yl)-trimethylstannane |
|---|---|
| PubChem CID | 15798780 |
| Molecular Formula | C13H28Sn2 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (3,4-diethyl-1,1-dimethyl-2,5-dihydrostannol-2-yl)-trimethylstannane |
| SMILES | CCC1=C(CC)C([Sn](C)(C)C)[Sn](C)(C)C1 |
| InChI | InChI=1S/C8H13.5CH3.2Sn/c1-5-7(3)8(4)6-2;;;;;;;/h3H,4-6H2,1-2H3;5*1H3;;/b8-7-;;;;;;; |
| InChIKey | LHXYYLIEOPZVMB-XPSMGOJQSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|