C12H25BSn — CID 135048460
diethyl-(4-ethyl-1,1-dimethyl-2,5-dihydrostannol-3-yl)borane (PubChem CID 135048460) has the molecular formula C12H25BSn and a molecular weight of 298.85 g/mol. Its IUPAC name is diethyl-(4-ethyl-1,1-dimethyl-2,5-dihydrostannol-3-yl)borane.
| Compound Name | diethyl-(4-ethyl-1,1-dimethyl-2,5-dihydrostannol-3-yl)borane |
|---|---|
| PubChem CID | 135048460 |
| Molecular Formula | C12H25BSn |
| Molecular Weight | 298.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | diethyl-(4-ethyl-1,1-dimethyl-2,5-dihydrostannol-3-yl)borane |
| SMILES | CCB(CC)C1=C(CC)C[Sn](C)(C)C1 |
| InChI | InChI=1S/C10H19B.2CH3.Sn/c1-6-9(4)10(5)11(7-2)8-3;;;/h4-8H2,1-3H3;2*1H3;/b10-9-;;; |
| InChIKey | PYFAZXIKJJBOPB-BZKIHGKGSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|