C12H22B2 — CID 14292377
4,5-diethyl-1,3-dimethyl-2-propan-2-ylidene-1,3-diborole (PubChem CID 14292377) has the molecular formula C12H22B2 and a molecular weight of 187.93 g/mol. Its IUPAC name is 4,5-diethyl-1,3-dimethyl-2-propan-2-ylidene-1,3-diborole.
| Compound Name | 4,5-diethyl-1,3-dimethyl-2-propan-2-ylidene-1,3-diborole |
|---|---|
| PubChem CID | 14292377 |
| Molecular Formula | C12H22B2 |
| Molecular Weight | 187.93 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 4,5-diethyl-1,3-dimethyl-2-propan-2-ylidene-1,3-diborole |
| SMILES | CCC1=C(CC)B(C)C(=C(C)C)B1C |
| InChI | InChI=1S/C12H22B2/c1-7-10-11(8-2)14(6)12(9(3)4)13(10)5/h7-8H2,1-6H3 |
| InChIKey | WMBHHLCKLBYKSA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|