C10H16B2Cl2 — CID 14292374
1,3-dichloro-4,5-diethyl-2-propan-2-ylidene-1,3-diborole (PubChem CID 14292374) has the molecular formula C10H16B2Cl2 and a molecular weight of 228.77 g/mol. Its IUPAC name is 1,3-dichloro-4,5-diethyl-2-propan-2-ylidene-1,3-diborole.
| Compound Name | 1,3-dichloro-4,5-diethyl-2-propan-2-ylidene-1,3-diborole |
|---|---|
| PubChem CID | 14292374 |
| Molecular Formula | C10H16B2Cl2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1,3-dichloro-4,5-diethyl-2-propan-2-ylidene-1,3-diborole |
| SMILES | CCC1=C(CC)B(Cl)C(=C(C)C)B1Cl |
| InChI | InChI=1S/C10H16B2Cl2/c1-5-8-9(6-2)12(14)10(7(3)4)11(8)13/h5-6H2,1-4H3 |
| InChIKey | WYWVLYAFGKYABT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|