About 1-chloro-4,5-diethyl-2,3-dihydroborole
1-chloro-4,5-diethyl-2,3-dihydroborole (PubChem CID 125480536) has the molecular formula C8H14BCl
and a molecular weight of 156.47 g/mol. Its IUPAC name is 1-chloro-4,5-diethyl-2,3-dihydroborole.
Molecular Properties
| Compound Name | 1-chloro-4,5-diethyl-2,3-dihydroborole |
| PubChem CID | 125480536 |
| Molecular Formula | C8H14BCl |
| Molecular Weight | 156.47 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-chloro-4,5-diethyl-2,3-dihydroborole |
| SMILES | CCC1=C(CC)B(Cl)CC1 |
| InChI | InChI=1S/C8H14BCl/c1-3-7-5-6-9(10)8(7)4-2/h3-6H2,1-2H3 |
| InChIKey | LUTCXFWWZKQCDJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4,5-diethyl-2,3-dihydroborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4,5-diethyl-2,3-dihydroborole?
The IUPAC name of 1-chloro-4,5-diethyl-2,3-dihydroborole (CID 125480536) is 1-chloro-4,5-diethyl-2,3-dihydroborole.
What is the SMILES notation for 1-chloro-4,5-diethyl-2,3-dihydroborole?
The canonical SMILES for 1-chloro-4,5-diethyl-2,3-dihydroborole is CCC1=C(CC)B(Cl)CC1.
What is the InChIKey of 1-chloro-4,5-diethyl-2,3-dihydroborole?
The InChIKey is LUTCXFWWZKQCDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BCl/c1-3-7-5-6-9(10)8(7)4-2/h3-6H2,1-2H3.
What are the key properties of 1-chloro-4,5-diethyl-2,3-dihydroborole?
1-chloro-4,5-diethyl-2,3-dihydroborole has a molecular weight of 156.47 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4,5-diethyl-2,3-dihydroborole is sourced from PubChem (CID 125480536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).