C18H39BSn2 — CID 13227106
trimethyl-(1,2,5-triethyl-3,4-dimethyl-5-trimethylstannylborol-2-yl)stannane (PubChem CID 13227106) has the molecular formula C18H39BSn2 and a molecular weight of 503.74 g/mol. Its IUPAC name is trimethyl-(1,2,5-triethyl-3,4-dimethyl-5-trimethylstannylborol-2-yl)stannane.
| Compound Name | trimethyl-(1,2,5-triethyl-3,4-dimethyl-5-trimethylstannylborol-2-yl)stannane |
|---|---|
| PubChem CID | 13227106 |
| Molecular Formula | C18H39BSn2 |
| Molecular Weight | 503.74 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | trimethyl-(1,2,5-triethyl-3,4-dimethyl-5-trimethylstannylborol-2-yl)stannane |
| SMILES | CCB1C(CC)([Sn](C)(C)C)C(C)=C(C)C1(CC)[Sn](C)(C)C |
| InChI | InChI=1S/C12H21B.6CH3.2Sn/c1-6-11-9(4)10(5)12(7-2)13(11)8-3;;;;;;;;/h6-8H2,1-5H3;6*1H3;; |
| InChIKey | PLULCCDFQPLBCC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|