C16H30Sn — CID 134890572
1,1-dibutyl-2,3,4,5-tetramethylstannole (PubChem CID 134890572) has the molecular formula C16H30Sn and a molecular weight of 341.13 g/mol. Its IUPAC name is 1,1-dibutyl-2,3,4,5-tetramethylstannole.
| Compound Name | 1,1-dibutyl-2,3,4,5-tetramethylstannole |
|---|---|
| PubChem CID | 134890572 |
| Molecular Formula | C16H30Sn |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1,1-dibutyl-2,3,4,5-tetramethylstannole |
| SMILES | CCCC[Sn]1(CCCC)C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C8H12.2C4H9.Sn/c1-5-7(3)8(4)6-2;2*1-3-4-2;/h1-4H3;2*1,3-4H2,2H3; |
| InChIKey | ZOGDYKDMEYLJJR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |