C16H24 — CID 12750030
(1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene (PubChem CID 12750030) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene.
| Compound Name | (1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 12750030 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene |
| SMILES | CC1=C(C)/C(C)=C(C)\C(C)=C(C)/C(C)=C\1C |
| InChI | InChI=1S/C16H24/c1-9-10(2)12(4)14(6)16(8)15(7)13(5)11(9)3/h1-8H3/b10-9-,11-9-,12-10-,13-11-,14-12-,15-13-,16-14-,16-15- |
| InChIKey | FTNIINPIHPQOCK-NNXHHTRFSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |