C9H15N2NaO3 — CID 101069143
sodium N-[(1R)-5-amino-1-carboxypentyl]prop-2-enimidate (PubChem CID 101069143) has the molecular formula C9H15N2NaO3 and a molecular weight of 222.22 g/mol. Its IUPAC name is sodium N-[(1R)-5-amino-1-carboxypentyl]prop-2-enimidate.
| Compound Name | sodium N-[(1R)-5-amino-1-carboxypentyl]prop-2-enimidate |
|---|---|
| PubChem CID | 101069143 |
| Molecular Formula | C9H15N2NaO3 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | sodium N-[(1R)-5-amino-1-carboxypentyl]prop-2-enimidate |
| SMILES | C=C/C([O-])=N\[C@H](CCCCN)C(=O)O.[Na+] |
| InChI | InChI=1S/C9H16N2O3.Na/c1-2-8(12)11-7(9(13)14)5-3-4-6-10;/h2,7H,1,3-6,10H2,(H,11,12)(H,13,14);/q;+1/p-1/t7-;/m1./s1 |
| InChIKey | DOQYOWPDIMRYAL-OGFXRTJISA-M |
| XLogP | -3.48 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|