C26H28F3NO8 — CID 101069641
trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate (PubChem CID 101069641) has the molecular formula C26H28F3NO8 and a molecular weight of 539.50 g/mol. Its IUPAC name is trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate.
| Compound Name | trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 101069641 |
| Molecular Formula | C26H28F3NO8 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-naphthalen-1-ylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate |
| SMILES | C=C(C[C@](O)(C[C@@H](C(=O)OC)N(C(=O)C(F)(F)F)[C@H](C)c1cccc2ccccc12)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C26H28F3NO8/c1-15(21(31)36-3)13-25(35,24(34)38-5)14-20(22(32)37-4)30(23(33)26(27,28)29)16(2)18-12-8-10-17-9-6-7-11-19(17)18/h6-12,16,20,35H,1,13-14H2,2-5H3/t16-,20+,25+/m1/s1 |
| InChIKey | HUNVTIHRLBMUKG-BXEPQMNJSA-N |
| XLogP | 3.25 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|