C20H24F3NO6 — CID 101069636
dimethyl (2S,4S)-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-2-prop-2-enylpentanedioate (PubChem CID 101069636) has the molecular formula C20H24F3NO6 and a molecular weight of 431.41 g/mol. Its IUPAC name is dimethyl (2S,4S)-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-2-prop-2-enylpentanedioate.
| Compound Name | dimethyl (2S,4S)-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-2-prop-2-enylpentanedioate |
|---|---|
| PubChem CID | 101069636 |
| Molecular Formula | C20H24F3NO6 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | dimethyl (2S,4S)-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]-2-prop-2-enylpentanedioate |
| SMILES | C=CC[C@](O)(C[C@@H](C(=O)OC)N(C(=O)C(F)(F)F)[C@H](C)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H24F3NO6/c1-5-11-19(28,18(27)30-4)12-15(16(25)29-3)24(17(26)20(21,22)23)13(2)14-9-7-6-8-10-14/h5-10,13,15,28H,1,11-12H2,2-4H3/t13-,15+,19+/m1/s1 |
| InChIKey | MPVADXGTVJJBII-WTANOLMUSA-N |
| XLogP | 2.55 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|