C22H26F3NO8 — CID 101069640
trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate (PubChem CID 101069640) has the molecular formula C22H26F3NO8 and a molecular weight of 489.44 g/mol. Its IUPAC name is trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate.
| Compound Name | trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 101069640 |
| Molecular Formula | C22H26F3NO8 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | trimethyl (1S,3S)-3-hydroxy-1-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]hex-5-ene-1,3,5-tricarboxylate |
| SMILES | C=C(C[C@](O)(C[C@@H](C(=O)OC)N(C(=O)C(F)(F)F)[C@H](C)c1ccccc1)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H26F3NO8/c1-13(17(27)32-3)11-21(31,20(30)34-5)12-16(18(28)33-4)26(19(29)22(23,24)25)14(2)15-9-7-6-8-10-15/h6-10,14,16,31H,1,11-12H2,2-5H3/t14-,16+,21+/m1/s1 |
| InChIKey | WRUXFOOPLDBCBS-ZJTDPSCFSA-N |
| XLogP | 2.09 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|