C27H34F3NO8 — CID 101246820
dimethyl (2S,4S)-2-[(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenebut-3-enyl]-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate (PubChem CID 101246820) has the molecular formula C27H34F3NO8 and a molecular weight of 557.56 g/mol. Its IUPAC name is dimethyl (2S,4S)-2-[(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenebut-3-enyl]-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate.
| Compound Name | dimethyl (2S,4S)-2-[(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenebut-3-enyl]-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 101246820 |
| Molecular Formula | C27H34F3NO8 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | dimethyl (2S,4S)-2-[(Z)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methylidenebut-3-enyl]-2-hydroxy-4-[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]pentanedioate |
| SMILES | C=C(/C=C\[C@H]1COC(C)(C)O1)C[C@](O)(C[C@@H](C(=O)OC)N(C(=O)C(F)(F)F)[C@H](C)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C27H34F3NO8/c1-17(12-13-20-16-38-25(3,4)39-20)14-26(35,24(34)37-6)15-21(22(32)36-5)31(23(33)27(28,29)30)18(2)19-10-8-7-9-11-19/h7-13,18,20-21,35H,1,14-16H2,2-6H3/b13-12-/t18-,20+,21+,26+/m1/s1 |
| InChIKey | UHKWWMPEWIKZOF-LNUXEVASSA-N |
| XLogP | 3.63 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|