C28H30N2O3 — CID 101069666
(3R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenylmethoxyazetidin-2-one (PubChem CID 101069666) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (3R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 101069666 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (3R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-3-phenylmethoxyazetidin-2-one |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1N1C[C@@H](OCc2ccccc2)C1=O |
| InChI | InChI=1S/C28H30N2O3/c1-32-28(23-14-7-3-8-15-23,24-16-9-4-10-17-24)26-18-11-19-29(26)30-20-25(27(30)31)33-21-22-12-5-2-6-13-22/h2-10,12-17,25-26H,11,18-21H2,1H3/t25-,26+/m1/s1 |
| InChIKey | YQECUQHTLYTIPV-FTJBHMTQSA-N |
| XLogP | 4.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |