C25H40N2O3 — CID 101166701
(3R,4S)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-4-pentyl-3-phenylmethoxyazetidin-2-one (PubChem CID 101166701) has the molecular formula C25H40N2O3 and a molecular weight of 416.61 g/mol. Its IUPAC name is (3R,4S)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-4-pentyl-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4S)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-4-pentyl-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 101166701 |
| Molecular Formula | C25H40N2O3 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | (3R,4S)-1-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-4-pentyl-3-phenylmethoxyazetidin-2-one |
| SMILES | CCCCC[C@H]1[C@@H](OCc2ccccc2)C(=O)N1N1CCC[C@H]1C(CC)(CC)OC |
| InChI | InChI=1S/C25H40N2O3/c1-5-8-10-16-21-23(30-19-20-14-11-9-12-15-20)24(28)27(21)26-18-13-17-22(26)25(6-2,7-3)29-4/h9,11-12,14-15,21-23H,5-8,10,13,16-19H2,1-4H3/t21-,22-,23+/m0/s1 |
| InChIKey | CFIMZNRFVHZUEH-RJGXRXQPSA-N |
| XLogP | 4.95 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|