C27H43NO2Sn — CID 15470883
(1S,3S,4R,5R)-3-phenyl-6-prop-2-enyl-4-(tributylstannylmethyl)-2-oxa-6-azabicyclo[3.2.0]heptan-7-one (PubChem CID 15470883) has the molecular formula C27H43NO2Sn and a molecular weight of 532.36 g/mol. Its IUPAC name is (1S,3S,4R,5R)-3-phenyl-6-prop-2-enyl-4-(tributylstannylmethyl)-2-oxa-6-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1S,3S,4R,5R)-3-phenyl-6-prop-2-enyl-4-(tributylstannylmethyl)-2-oxa-6-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 15470883 |
| Molecular Formula | C27H43NO2Sn |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | (1S,3S,4R,5R)-3-phenyl-6-prop-2-enyl-4-(tributylstannylmethyl)-2-oxa-6-azabicyclo[3.2.0]heptan-7-one |
| SMILES | C=CCN1C(=O)[C@H]2O[C@H](c3ccccc3)[C@H](C[Sn](CCCC)(CCCC)CCCC)[C@H]21 |
| InChI | InChI=1S/C15H16NO2.3C4H9.Sn/c1-3-9-16-12-10(2)13(18-14(12)15(16)17)11-7-5-4-6-8-11;3*1-3-4-2;/h3-8,10,12-14H,1-2,9H2;3*1,3-4H2,2H3;/t10-,12-,13+,14+;;;;/m1..../s1 |
| InChIKey | GZGQCWPLCRQETG-NZSJHCMVSA-N |
| XLogP | 6.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|