C17H20N2O3 — CID 134867352
2-[(2S,3S)-3-methoxy-2-(2-methyl-3-phenyloxiran-2-yl)-4-oxoazetidin-1-yl]-2-methylpropanenitrile (PubChem CID 134867352) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(2S,3S)-3-methoxy-2-(2-methyl-3-phenyloxiran-2-yl)-4-oxoazetidin-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[(2S,3S)-3-methoxy-2-(2-methyl-3-phenyloxiran-2-yl)-4-oxoazetidin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 134867352 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[(2S,3S)-3-methoxy-2-(2-methyl-3-phenyloxiran-2-yl)-4-oxoazetidin-1-yl]-2-methylpropanenitrile |
| SMILES | CO[C@@H]1C(=O)N(C(C)(C)C#N)[C@@H]1C1(C)OC1c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c1-16(2,10-18)19-13(12(21-4)15(19)20)17(3)14(22-17)11-8-6-5-7-9-11/h5-9,12-14H,1-4H3/t12-,13-,14?,17?/m0/s1 |
| InChIKey | GTNRNMFQSDXFBO-YRFCHQJDSA-N |
| XLogP | 2.04 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|