C16H18N2O3 — CID 16756605
2-[(3S,4R)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]-2-methylpropanenitrile (PubChem CID 16756605) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[(3S,4R)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[(3S,4R)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 16756605 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[(3S,4R)-3-methoxy-2-oxo-4-[(2S,3S)-3-phenyloxiran-2-yl]azetidin-1-yl]-2-methylpropanenitrile |
| SMILES | CO[C@@H]1C(=O)N(C(C)(C)C#N)[C@@H]1[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c1-16(2,9-17)18-11(14(20-3)15(18)19)13-12(21-13)10-7-5-4-6-8-10/h4-8,11-14H,1-3H3/t11-,12+,13+,14+/m1/s1 |
| InChIKey | ORCZOVVOYUZAAZ-RFGFWPKPSA-N |
| XLogP | 1.65 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|