C16H20O — CID 101070766
(8aS)-2,8a-bis(prop-2-enyl)-2,3,4,6-tetrahydronaphthalen-1-one (PubChem CID 101070766) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (8aS)-2,8a-bis(prop-2-enyl)-2,3,4,6-tetrahydronaphthalen-1-one.
| Compound Name | (8aS)-2,8a-bis(prop-2-enyl)-2,3,4,6-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 101070766 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (8aS)-2,8a-bis(prop-2-enyl)-2,3,4,6-tetrahydronaphthalen-1-one |
| SMILES | C=CCC1CCC2=CCC=C[C@]2(CC=C)C1=O |
| InChI | InChI=1S/C16H20O/c1-3-7-13-9-10-14-8-5-6-12-16(14,11-4-2)15(13)17/h3-4,6,8,12-13H,1-2,5,7,9-11H2/t13?,16-/m0/s1 |
| InChIKey | YSRMGSQFAFSBTF-VYIIXAMBSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|