C20H42O2Si3 — CID 101071575
(4E,6S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(trimethylsilyl)cyclooct-4-en-1-one (PubChem CID 101071575) has the molecular formula C20H42O2Si3 and a molecular weight of 398.81 g/mol. Its IUPAC name is (4E,6S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(trimethylsilyl)cyclooct-4-en-1-one.
| Compound Name | (4E,6S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(trimethylsilyl)cyclooct-4-en-1-one |
|---|---|
| PubChem CID | 101071575 |
| Molecular Formula | C20H42O2Si3 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (4E,6S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6,7-bis(trimethylsilyl)cyclooct-4-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O/C1=C/[C@H]([Si](C)(C)C)[C@H]([Si](C)(C)C)CC(=O)CC1 |
| InChI | InChI=1S/C20H42O2Si3/c1-20(2,3)25(10,11)22-17-13-12-16(21)14-18(23(4,5)6)19(15-17)24(7,8)9/h15,18-19H,12-14H2,1-11H3/b17-15+/t18-,19+/m1/s1 |
| InChIKey | DQZKAQKBXSTUGG-QUEUWKNVSA-N |
| XLogP | 7.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|