C20H40O2Si2 — CID 135067248
(4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-propyl-6-trimethylsilylcyclooct-4-en-1-one (PubChem CID 135067248) has the molecular formula C20H40O2Si2 and a molecular weight of 368.71 g/mol. Its IUPAC name is (4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-propyl-6-trimethylsilylcyclooct-4-en-1-one.
| Compound Name | (4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-propyl-6-trimethylsilylcyclooct-4-en-1-one |
|---|---|
| PubChem CID | 135067248 |
| Molecular Formula | C20H40O2Si2 |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (4E,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-propyl-6-trimethylsilylcyclooct-4-en-1-one |
| SMILES | CCC[C@@H]1CC(=O)CC/C(O[Si](C)(C)C(C)(C)C)=C\[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C20H40O2Si2/c1-10-11-16-14-17(21)12-13-18(15-19(16)23(5,6)7)22-24(8,9)20(2,3)4/h15-16,19H,10-14H2,1-9H3/b18-15+/t16-,19+/m1/s1 |
| InChIKey | JIZOEHGDPDWHMZ-JCNNABAYSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|