C18H32O3Si — CID 101073668
(1S,2R,5R)-1,5-dimethyl-2-tri(propan-2-yl)silyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 101073668) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is (1S,2R,5R)-1,5-dimethyl-2-tri(propan-2-yl)silyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,5R)-1,5-dimethyl-2-tri(propan-2-yl)silyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 101073668 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (1S,2R,5R)-1,5-dimethyl-2-tri(propan-2-yl)silyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC(C)[Si](O[C@H]1C(=O)C[C@]2(C)C=C[C@]1(C)O2)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-12(2)22(13(3)4,14(5)6)20-16-15(19)11-17(7)9-10-18(16,8)21-17/h9-10,12-14,16H,11H2,1-8H3/t16-,17-,18-/m0/s1 |
| InChIKey | QYDBHXFJQNDUNU-BZSNNMDCSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|