C21H25N3O2 — CID 101074497
ethyl (E)-3-[(2S)-1-[(Z)-2-cyano-3-[(1R)-1-phenylethyl]iminoprop-1-enyl]pyrrolidin-2-yl]prop-2-enoate (PubChem CID 101074497) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl (E)-3-[(2S)-1-[(Z)-2-cyano-3-[(1R)-1-phenylethyl]iminoprop-1-enyl]pyrrolidin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S)-1-[(Z)-2-cyano-3-[(1R)-1-phenylethyl]iminoprop-1-enyl]pyrrolidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101074497 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | ethyl (E)-3-[(2S)-1-[(Z)-2-cyano-3-[(1R)-1-phenylethyl]iminoprop-1-enyl]pyrrolidin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1CCCN1/C=C(C#N)/C=N/[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-26-21(25)12-11-20-10-7-13-24(20)16-18(14-22)15-23-17(2)19-8-5-4-6-9-19/h4-6,8-9,11-12,15-17,20H,3,7,10,13H2,1-2H3/b12-11+,18-16+,23-15+/t17-,20+/m1/s1 |
| InChIKey | OCUHIIMDKVBGOQ-FDTMCJMRSA-N |
| XLogP | 3.81 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|