About [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane
[(Z)-1,2-difluorodec-1-enyl]-trimethylsilane (PubChem CID 101074942) has the molecular formula C13H26F2Si
and a molecular weight of 248.43 g/mol. Its IUPAC name is [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane |
| PubChem CID | 101074942 |
| Molecular Formula | C13H26F2Si |
| Molecular Weight | 248.43 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane |
| SMILES | CCCCCCCC/C(F)=C(\F)[Si](C)(C)C |
| InChI | InChI=1S/C13H26F2Si/c1-5-6-7-8-9-10-11-12(14)13(15)16(2,3)4/h5-11H2,1-4H3/b13-12- |
| InChIKey | HDDHRTQLIUJQPX-SEYXRHQNSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane?
The IUPAC name of [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane (CID 101074942) is [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane.
What is the SMILES notation for [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane?
The canonical SMILES for [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane is CCCCCCCC/C(F)=C(\F)[Si](C)(C)C.
What is the InChIKey of [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane?
The InChIKey is HDDHRTQLIUJQPX-SEYXRHQNSA-N. The full InChI is InChI=1S/C13H26F2Si/c1-5-6-7-8-9-10-11-12(14)13(15)16(2,3)4/h5-11H2,1-4H3/b13-12-.
What are the key properties of [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane?
[(Z)-1,2-difluorodec-1-enyl]-trimethylsilane has a molecular weight of 248.43 g/mol, XLogP of 5.76, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,2-difluorodec-1-enyl]-trimethylsilane is sourced from PubChem (CID 101074942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).