C12H24F2Si — CID 10966453
1,1-difluoronon-1-en-3-yl(trimethyl)silane (PubChem CID 10966453) has the molecular formula C12H24F2Si and a molecular weight of 234.41 g/mol. Its IUPAC name is 1,1-difluoronon-1-en-3-yl(trimethyl)silane.
| Compound Name | 1,1-difluoronon-1-en-3-yl(trimethyl)silane |
|---|---|
| PubChem CID | 10966453 |
| Molecular Formula | C12H24F2Si |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1,1-difluoronon-1-en-3-yl(trimethyl)silane |
| SMILES | CCCCCCC(C=C(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C12H24F2Si/c1-5-6-7-8-9-11(10-12(13)14)15(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | HDZUIOHXWGGBIC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|